Input SMILES notation of the compound.For example:Structure of Taxifolin
can be designated as C1=CC(=C(C=C1C2C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O